chijiokeazu1 chijiokeazu1

25-01-2024
Mathematics

contestada

cos(x+pi/6)-cos(x-pi/6)=1
How do I solve this by using the sum and difference formulas?

Relax

Respuesta :

Otras preguntas

What were three pieces of evidence that wegener used to explain continental drift? Whydid people not believe in this history

14% of 81 is what number?

what does begin with end in mind mean?

what is 73.4 rounded to the nearest tenth and hundreth

The glands that produce digestive fluids, the mucus-producing tissue lining the stomach, and muscle tissue helps make up what? A:cell B:tissue C:organ D:organ

you buy six notebooks and a backpack. The cost of the backpack is$ 17.90. You pay 6% in sales tax. Your total bill is $30.74 how much does each notebook cost?

Which of the following statements is true regarding gender equality in Southeast Asia? A. Mao Zedong declared that “Women hold up half the sky.” B. South Kore

Something that affects the structure or function of an organism is referred to as a __________. a)modifier b)rash c)disease d)symptom

Why was Congress reluctant to approve the Marshall Plan? What forced them to make a decision?

1.2k+2.4 Factor out the coefficient of the variable and find the greatest common factor